C24H30N4O4 — CID 95352183
3-[(4aR,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[3-(2-oxoazepan-1-yl)propyl]benzamide (PubChem CID 95352183) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[(4aR,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[3-(2-oxoazepan-1-yl)propyl]benzamide.
| Compound Name | 3-[(4aR,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[3-(2-oxoazepan-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 95352183 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[(4aR,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[3-(2-oxoazepan-1-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1CCCCCC1=O)c1cccc(N2NC(=O)[C@@H]3CC=CC[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C24H30N4O4/c29-21-12-2-1-5-14-27(21)15-7-13-25-22(30)17-8-6-9-18(16-17)28-24(32)20-11-4-3-10-19(20)23(31)26-28/h3-4,6,8-9,16,19-20H,1-2,5,7,10-15H2,(H,25,30)(H,26,31)/t19-,20+/m1/s1 |
| InChIKey | ZQXCXKRCBHSUFA-UXHICEINSA-N |
| XLogP | 2.17 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|