C19H23N3O4 — CID 51126854
3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-(2-ethoxyethyl)benzamide (PubChem CID 51126854) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-(2-ethoxyethyl)benzamide.
| Compound Name | 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-(2-ethoxyethyl)benzamide |
|---|---|
| PubChem CID | 51126854 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-(2-ethoxyethyl)benzamide |
| SMILES | CCOCCNC(=O)c1cccc(N2NC(=O)C3CC=CCC3C2=O)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-26-11-10-20-17(23)13-6-5-7-14(12-13)22-19(25)16-9-4-3-8-15(16)18(24)21-22/h3-7,12,15-16H,2,8-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HTOAPYHHFYEHBH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|