C22H26N2O4 — CID 95161436
cycloheptyl 3-[(4aR,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]benzoate (PubChem CID 95161436) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is cycloheptyl 3-[(4aR,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]benzoate.
| Compound Name | cycloheptyl 3-[(4aR,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]benzoate |
|---|---|
| PubChem CID | 95161436 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | cycloheptyl 3-[(4aR,8aR)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]benzoate |
| SMILES | O=C(OC1CCCCCC1)c1cccc(N2NC(=O)[C@@H]3CC=CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C22H26N2O4/c25-20-18-12-5-6-13-19(18)21(26)24(23-20)16-9-7-8-15(14-16)22(27)28-17-10-3-1-2-4-11-17/h5-9,14,17-19H,1-4,10-13H2,(H,23,25)/t18-,19-/m1/s1 |
| InChIKey | BTZHVPKRSYINKM-RTBURBONSA-N |
| XLogP | 3.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|