C22H20ClN3O3 — CID 97011153
3-[(4aS,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[(3-chlorophenyl)methyl]benzamide (PubChem CID 97011153) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 3-[(4aS,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[(3-chlorophenyl)methyl]benzamide.
| Compound Name | 3-[(4aS,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[(3-chlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 97011153 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 3-[(4aS,8aS)-1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl]-N-[(3-chlorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cccc(N2NC(=O)[C@H]3CC=CC[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C22H20ClN3O3/c23-16-7-3-5-14(11-16)13-24-20(27)15-6-4-8-17(12-15)26-22(29)19-10-2-1-9-18(19)21(28)25-26/h1-8,11-12,18-19H,9-10,13H2,(H,24,27)(H,25,28)/t18-,19-/m0/s1 |
| InChIKey | VBPCUARSTJADDL-OALUTQOASA-N |
| XLogP | 3.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|