C35H42NO5+ — CID 95370479
2-[(1S,2R,4R,5R,6R,7S,8S,10R,11R)-8-benzoyloxy-6-hydroxy-5,11-dimethyl-13-azoniapentacyclo[9.3.3.14,7.01,10.02,7]octadec-13-en-13-yl]ethyl benzoate (PubChem CID 95370479) has the molecular formula C35H42NO5+ and a molecular weight of 556.72 g/mol. Its IUPAC name is 2-[(1S,2R,4R,5R,6R,7S,8S,10R,11R)-8-benzoyloxy-6-hydroxy-5,11-dimethyl-13-azoniapentacyclo[9.3.3.14,7.01,10.02,7]octadec-13-en-13-yl]ethyl benzoate.
| Compound Name | 2-[(1S,2R,4R,5R,6R,7S,8S,10R,11R)-8-benzoyloxy-6-hydroxy-5,11-dimethyl-13-azoniapentacyclo[9.3.3.14,7.01,10.02,7]octadec-13-en-13-yl]ethyl benzoate |
|---|---|
| PubChem CID | 95370479 |
| Molecular Formula | C35H42NO5+ |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 2-[(1S,2R,4R,5R,6R,7S,8S,10R,11R)-8-benzoyloxy-6-hydroxy-5,11-dimethyl-13-azoniapentacyclo[9.3.3.14,7.01,10.02,7]octadec-13-en-13-yl]ethyl benzoate |
| SMILES | C[C@@H]1[C@@H]2C[C@@H]3[C@]45C=[N+](CCOC(=O)c6ccccc6)C[C@](C)(CCC4)[C@H]5C[C@H](OC(=O)c4ccccc4)[C@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C35H42NO5/c1-23-26-18-28-34-15-9-14-33(2,21-36(22-34)16-17-40-31(38)24-10-5-3-6-11-24)27(34)19-29(35(28,20-26)30(23)37)41-32(39)25-12-7-4-8-13-25/h3-8,10-13,22-23,26-30,37H,9,14-21H2,1-2H3/q+1/t23-,26-,27-,28-,29+,30-,33+,34+,35-/m1/s1 |
| InChIKey | ZGJNBFONRAJFJM-JVPSQRDGSA-N |
| XLogP | 5.39 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|