C26H31NO2 — CID 11269283
2-[(2R,3S,7R,8S,10R,11R,12R,16R)-16-methyl-1-azahexacyclo[8.7.0.02,12.03,8.07,12.011,16]heptadec-4-en-8-yl]ethyl benzoate (PubChem CID 11269283) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[(2R,3S,7R,8S,10R,11R,12R,16R)-16-methyl-1-azahexacyclo[8.7.0.02,12.03,8.07,12.011,16]heptadec-4-en-8-yl]ethyl benzoate.
| Compound Name | 2-[(2R,3S,7R,8S,10R,11R,12R,16R)-16-methyl-1-azahexacyclo[8.7.0.02,12.03,8.07,12.011,16]heptadec-4-en-8-yl]ethyl benzoate |
|---|---|
| PubChem CID | 11269283 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 2-[(2R,3S,7R,8S,10R,11R,12R,16R)-16-methyl-1-azahexacyclo[8.7.0.02,12.03,8.07,12.011,16]heptadec-4-en-8-yl]ethyl benzoate |
| SMILES | C[C@@]12CCC[C@]34[C@@H]1[C@H]1C[C@@]5(CCOC(=O)c6ccccc6)[C@H](C=CC[C@H]53)[C@H]4N1C2 |
| InChI | InChI=1S/C26H31NO2/c1-24-11-6-12-26-20-10-5-9-18-22(26)27(16-24)19(21(24)26)15-25(18,20)13-14-29-23(28)17-7-3-2-4-8-17/h2-5,7-9,18-22H,6,10-16H2,1H3/t18-,19-,20-,21-,22-,24+,25+,26-/m1/s1 |
| InChIKey | CQXKTNMLMFCGGX-IOCLCRHGSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|