C35H36FN5O3 — CID 95373865
2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 95373865) has the molecular formula C35H36FN5O3 and a molecular weight of 593.70 g/mol. Its IUPAC name is 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 95373865 |
| Molecular Formula | C35H36FN5O3 |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 2-[(10S,15S)-10-(4-fluorophenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccccc2N2C(=O)[C@@H]3Cc4c([nH]c5ccccc45)[C@H](c4ccc(F)cc4)N3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C35H36FN5O3/c1-34(2)18-22(19-35(3,4)39-34)37-31(42)24-10-6-8-12-27(24)41-32(43)28-17-25-23-9-5-7-11-26(23)38-29(25)30(40(28)33(41)44)20-13-15-21(36)16-14-20/h5-16,22,28,30,38-39H,17-19H2,1-4H3,(H,37,42)/t28-,30-/m0/s1 |
| InChIKey | QSNBJEHSESIERJ-JDXGNMNLSA-N |
| XLogP | 5.83 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|