C12H19N3O — CID 95444582
2-[3-(2,5-dimethylphenoxy)propyl]guanidine (PubChem CID 95444582) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenoxy)propyl]guanidine.
| Compound Name | 2-[3-(2,5-dimethylphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 95444582 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[3-(2,5-dimethylphenoxy)propyl]guanidine |
| SMILES | Cc1ccc(C)c(OCCCN=C(N)N)c1 |
| InChI | InChI=1S/C12H19N3O/c1-9-4-5-10(2)11(8-9)16-7-3-6-15-12(13)14/h4-5,8H,3,6-7H2,1-2H3,(H4,13,14,15) |
| InChIKey | DDINKDSPKATSPD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|