C12H14Cl2FN3O2 — CID 95571150
N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2,6-dichloro-5-fluoropyridine-3-carboxamide (PubChem CID 95571150) has the molecular formula C12H14Cl2FN3O2 and a molecular weight of 322.17 g/mol. Its IUPAC name is N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2,6-dichloro-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2,6-dichloro-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 95571150 |
| Molecular Formula | C12H14Cl2FN3O2 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2,6-dichloro-5-fluoropyridine-3-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cc(F)c(Cl)nc1Cl)C(N)=O |
| InChI | InChI=1S/C12H14Cl2FN3O2/c1-3-5(2)8(11(16)19)17-12(20)6-4-7(15)10(14)18-9(6)13/h4-5,8H,3H2,1-2H3,(H2,16,19)(H,17,20)/t5-,8-/m0/s1 |
| InChIKey | WPPSEPAHIYTLQW-XNCJUZBTSA-N |
| XLogP | 2.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|