C21H23N3O3S2 — CID 95574899
1-[(2-hydroxyphenyl)methyl]-3-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 95574899) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-3-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-3-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95574899 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-3-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | CSc1nc2ccc(NC(=O)N(Cc3ccccc3O)C[C@H]3CCCO3)cc2s1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-28-21-23-17-9-8-15(11-19(17)29-21)22-20(26)24(13-16-6-4-10-27-16)12-14-5-2-3-7-18(14)25/h2-3,5,7-9,11,16,25H,4,6,10,12-13H2,1H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | PSXZOCNERGXSQL-MRXNPFEDSA-N |
| XLogP | 4.94 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|