C15H19N5O2S — CID 95632428
(2S)-1-[4-(1,3-benzothiazol-2-ylamino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol (PubChem CID 95632428) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is (2S)-1-[4-(1,3-benzothiazol-2-ylamino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol.
| Compound Name | (2S)-1-[4-(1,3-benzothiazol-2-ylamino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 95632428 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (2S)-1-[4-(1,3-benzothiazol-2-ylamino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol |
| SMILES | CON(C)C[C@@H](O)Cn1cc(Nc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C15H19N5O2S/c1-19(22-2)9-12(21)10-20-8-11(7-16-20)17-15-18-13-5-3-4-6-14(13)23-15/h3-8,12,21H,9-10H2,1-2H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | GUORTPWDFBRESA-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|