C21H23N5O2 — CID 95723212
2-amino-6-(1,3-benzodioxol-5-yl)-4-[(3S)-piperidin-3-yl]-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile (PubChem CID 95723212) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-amino-6-(1,3-benzodioxol-5-yl)-4-[(3S)-piperidin-3-yl]-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(1,3-benzodioxol-5-yl)-4-[(3S)-piperidin-3-yl]-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 95723212 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-amino-6-(1,3-benzodioxol-5-yl)-4-[(3S)-piperidin-3-yl]-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1[C@@H]1CCCNC1)CN(c1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C21H23N5O2/c22-9-15-20(13-2-1-6-24-10-13)16-11-26(7-5-17(16)25-21(15)23)14-3-4-18-19(8-14)28-12-27-18/h3-4,8,13,24H,1-2,5-7,10-12H2,(H2,23,25)/t13-/m1/s1 |
| InChIKey | QIWLFIQQZIFLTF-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|