C17H27N3O4 — CID 95775943
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide (PubChem CID 95775943) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide |
|---|---|
| PubChem CID | 95775943 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N[C@@H]2[C@H]3CCO[C@@H]3C2(C)C)C1=O |
| InChI | InChI=1S/C17H27N3O4/c1-5-17(6-2)14(22)20(15(23)19-17)9-11(21)18-12-10-7-8-24-13(10)16(12,3)4/h10,12-13H,5-9H2,1-4H3,(H,18,21)(H,19,23)/t10-,12-,13+/m1/s1 |
| InChIKey | ZMMNQXGHVIZEJH-RTXFEEFZSA-N |
| XLogP | 1.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|