C17H26Cl2N2OS — CID 95783880
N-[(3,4-dichlorophenyl)methyl]-2-[[(2S)-4-ethylsulfanylbutan-2-yl]-methylamino]-N-methylacetamide (PubChem CID 95783880) has the molecular formula C17H26Cl2N2OS and a molecular weight of 377.38 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-[[(2S)-4-ethylsulfanylbutan-2-yl]-methylamino]-N-methylacetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-[[(2S)-4-ethylsulfanylbutan-2-yl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 95783880 |
| Molecular Formula | C17H26Cl2N2OS |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-[[(2S)-4-ethylsulfanylbutan-2-yl]-methylamino]-N-methylacetamide |
| SMILES | CCSCC[C@H](C)N(C)CC(=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H26Cl2N2OS/c1-5-23-9-8-13(2)20(3)12-17(22)21(4)11-14-6-7-15(18)16(19)10-14/h6-7,10,13H,5,8-9,11-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | ZXIWPXZEYZBKOR-ZDUSSCGKSA-N |
| XLogP | 4.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|