C21H26N6 — CID 95858388
(5aS,8aS)-1-[(3-methylphenyl)methyl]-7-(7H-purin-6-yl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepine (PubChem CID 95858388) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is (5aS,8aS)-1-[(3-methylphenyl)methyl]-7-(7H-purin-6-yl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepine.
| Compound Name | (5aS,8aS)-1-[(3-methylphenyl)methyl]-7-(7H-purin-6-yl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepine |
|---|---|
| PubChem CID | 95858388 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (5aS,8aS)-1-[(3-methylphenyl)methyl]-7-(7H-purin-6-yl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepine |
| SMILES | Cc1cccc(CN2CCCC[C@H]3CN(c4ncnc5nc[nH]c45)C[C@H]32)c1 |
| InChI | InChI=1S/C21H26N6/c1-15-5-4-6-16(9-15)10-26-8-3-2-7-17-11-27(12-18(17)26)21-19-20(23-13-22-19)24-14-25-21/h4-6,9,13-14,17-18H,2-3,7-8,10-12H2,1H3,(H,22,23,24,25)/t17-,18+/m0/s1 |
| InChIKey | FNVOTESIAURNHP-ZWKOTPCHSA-N |
| XLogP | 3.15 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |