C13H18N4O3 — CID 96512670
(3R)-3-[(2S)-2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]oxolan-2-one (PubChem CID 96512670) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3R)-3-[(2S)-2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]oxolan-2-one.
| Compound Name | (3R)-3-[(2S)-2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]oxolan-2-one |
|---|---|
| PubChem CID | 96512670 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3R)-3-[(2S)-2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1N1CCO[C@@H](CNc2cccnn2)C1 |
| InChI | InChI=1S/C13H18N4O3/c18-13-11(3-6-20-13)17-5-7-19-10(9-17)8-14-12-2-1-4-15-16-12/h1-2,4,10-11H,3,5-9H2,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | AAJTYMFREQMNFW-WDEREUQCSA-N |
| XLogP | -0.10 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |