C16H13Cl2N3O — CID 96536528
1-[(1S)-2-cyano-1-phenylethyl]-3-(2,5-dichlorophenyl)urea (PubChem CID 96536528) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is 1-[(1S)-2-cyano-1-phenylethyl]-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-[(1S)-2-cyano-1-phenylethyl]-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 96536528 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-[(1S)-2-cyano-1-phenylethyl]-3-(2,5-dichlorophenyl)urea |
| SMILES | N#CC[C@H](NC(=O)Nc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2N3O/c17-12-6-7-13(18)15(10-12)21-16(22)20-14(8-9-19)11-4-2-1-3-5-11/h1-7,10,14H,8H2,(H2,20,21,22)/t14-/m0/s1 |
| InChIKey | LNPBFPWYXGAYIV-AWEZNQCLSA-N |
| XLogP | 4.77 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |