C11H14N2O2 — CID 96617326
N,N-dimethyl-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indol-4-amine (PubChem CID 96617326) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is N,N-dimethyl-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indol-4-amine.
| Compound Name | N,N-dimethyl-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indol-4-amine |
|---|---|
| PubChem CID | 96617326 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N,N-dimethyl-6,7-dihydro-5H-[1,3]dioxolo[4,5-f]indol-4-amine |
| SMILES | CN(C)c1c2c(cc3c1OCO3)CCN2 |
| InChI | InChI=1S/C11H14N2O2/c1-13(2)10-9-7(3-4-12-9)5-8-11(10)15-6-14-8/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | WDYDQAKZZXQDTO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|