C7H5N3O2S — CID 96622827
3-(1,2-oxazol-3-yl)-2-sulfanylidene-1H-imidazole-4-carbaldehyde (PubChem CID 96622827) has the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-yl)-2-sulfanylidene-1H-imidazole-4-carbaldehyde.
| Compound Name | 3-(1,2-oxazol-3-yl)-2-sulfanylidene-1H-imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 96622827 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 3-(1,2-oxazol-3-yl)-2-sulfanylidene-1H-imidazole-4-carbaldehyde |
| SMILES | O=Cc1c[nH]c(=S)n1-c1ccon1 |
| InChI | InChI=1S/C7H5N3O2S/c11-4-5-3-8-7(13)10(5)6-1-2-12-9-6/h1-4H,(H,8,13) |
| InChIKey | GNYKTMDEEQNVJB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|