C9H11NOS — CID 96628187
5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine-1-carbaldehyde (PubChem CID 96628187) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine-1-carbaldehyde.
| Compound Name | 5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine-1-carbaldehyde |
|---|---|
| PubChem CID | 96628187 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 5,6,7,8-tetrahydro-4H-thieno[3,4-c]azepine-1-carbaldehyde |
| SMILES | O=Cc1scc2c1CCCNC2 |
| InChI | InChI=1S/C9H11NOS/c11-5-9-8-2-1-3-10-4-7(8)6-12-9/h5-6,10H,1-4H2 |
| InChIKey | CTGKVRCWOWYKFP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|