C21H18BrN3O3 — CID 97000083
(3R)-1-(2-bromophenyl)-N-(8-methoxyquinolin-5-yl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 97000083) has the molecular formula C21H18BrN3O3 and a molecular weight of 440.30 g/mol. Its IUPAC name is (3R)-1-(2-bromophenyl)-N-(8-methoxyquinolin-5-yl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-bromophenyl)-N-(8-methoxyquinolin-5-yl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97000083 |
| Molecular Formula | C21H18BrN3O3 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (3R)-1-(2-bromophenyl)-N-(8-methoxyquinolin-5-yl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CCN(c3ccccc3Br)C2=O)c2cccnc12 |
| InChI | InChI=1S/C21H18BrN3O3/c1-28-18-9-8-16(13-5-4-11-23-19(13)18)24-20(26)14-10-12-25(21(14)27)17-7-3-2-6-15(17)22/h2-9,11,14H,10,12H2,1H3,(H,24,26)/t14-/m1/s1 |
| InChIKey | GXOXWPDVRSGKJN-CQSZACIVSA-N |
| XLogP | 4.00 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|