C16H25N5O3 — CID 97007666
tert-butyl N-[(3S)-1-[6-(dimethylamino)pyridazine-3-carbonyl]pyrrolidin-3-yl]carbamate (PubChem CID 97007666) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[6-(dimethylamino)pyridazine-3-carbonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[6-(dimethylamino)pyridazine-3-carbonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 97007666 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | tert-butyl N-[(3S)-1-[6-(dimethylamino)pyridazine-3-carbonyl]pyrrolidin-3-yl]carbamate |
| SMILES | CN(C)c1ccc(C(=O)N2CC[C@H](NC(=O)OC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C16H25N5O3/c1-16(2,3)24-15(23)17-11-8-9-21(10-11)14(22)12-6-7-13(19-18-12)20(4)5/h6-7,11H,8-10H2,1-5H3,(H,17,23)/t11-/m0/s1 |
| InChIKey | KNWMRXHYFJCQLT-NSHDSACASA-N |
| XLogP | 1.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |