C12H16N2O3S2 — CID 97013025
(4aS,8aR)-4-thiophen-2-ylsulfonyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 97013025) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (4aS,8aR)-4-thiophen-2-ylsulfonyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aR)-4-thiophen-2-ylsulfonyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 97013025 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (4aS,8aR)-4-thiophen-2-ylsulfonyl-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cccs2)[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C12H16N2O3S2/c15-11-8-14(10-5-2-1-4-9(10)13-11)19(16,17)12-6-3-7-18-12/h3,6-7,9-10H,1-2,4-5,8H2,(H,13,15)/t9-,10+/m1/s1 |
| InChIKey | KNQQJJXVDMRNIJ-ZJUUUORDSA-N |
| XLogP | 1.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |