C18H16N4O3 — CID 97021807
4-[(4R)-1-[(2-methoxy-3-pyridinyl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 97021807) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[(4R)-1-[(2-methoxy-3-pyridinyl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[(4R)-1-[(2-methoxy-3-pyridinyl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 97021807 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[(4R)-1-[(2-methoxy-3-pyridinyl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | COc1ncccc1CN1C(=O)N[C@](C)(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C18H16N4O3/c1-18(14-7-5-12(10-19)6-8-14)16(23)22(17(24)21-18)11-13-4-3-9-20-15(13)25-2/h3-9H,11H2,1-2H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | XOZQMKHWKNUKEZ-GOSISDBHSA-N |
| XLogP | 1.93 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|