C9H9ClFNO — CID 97050015
(Z,1S)-1-amino-3-chloro-3-(4-fluorophenyl)prop-2-en-1-ol (PubChem CID 97050015) has the molecular formula C9H9ClFNO and a molecular weight of 201.63 g/mol. Its IUPAC name is (Z,1S)-1-amino-3-chloro-3-(4-fluorophenyl)prop-2-en-1-ol.
| Compound Name | (Z,1S)-1-amino-3-chloro-3-(4-fluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 97050015 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (Z,1S)-1-amino-3-chloro-3-(4-fluorophenyl)prop-2-en-1-ol |
| SMILES | N[C@@H](O)/C=C(\Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9ClFNO/c10-8(5-9(12)13)6-1-3-7(11)4-2-6/h1-5,9,13H,12H2/b8-5-/t9-/m0/s1 |
| InChIKey | FGZVSNRSFKFBIM-RDOCRHDPSA-N |
| XLogP | 1.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|