About (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide
(2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide (PubChem CID 97077207) has the molecular formula C18H17ClFNO3
and a molecular weight of 349.79 g/mol. Its IUPAC name is (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 97077207 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(N[C@@H](c1cccc(F)c1)c1cccc(Cl)c1)[C@H]1COCCO1 |
| InChI | InChI=1S/C18H17ClFNO3/c19-14-5-1-3-12(9-14)17(13-4-2-6-15(20)10-13)21-18(22)16-11-23-7-8-24-16/h1-6,9-10,16-17H,7-8,11H2,(H,21,22)/t16-,17-/m1/s1 |
| InChIKey | YCUIBCUGRAWNDN-IAGOWNOFSA-N |
| XLogP | 3.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide?
The IUPAC name of (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide (CID 97077207) is (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide is O=C(N[C@@H](c1cccc(F)c1)c1cccc(Cl)c1)[C@H]1COCCO1.
What is the InChIKey of (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide?
The InChIKey is YCUIBCUGRAWNDN-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H17ClFNO3/c19-14-5-1-3-12(9-14)17(13-4-2-6-15(20)10-13)21-18(22)16-11-23-7-8-24-16/h1-6,9-10,16-17H,7-8,11H2,(H,21,22)/t16-,17-/m1/s1.
What are the key properties of (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide?
(2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide has a molecular weight of 349.79 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(S)-(3-chlorophenyl)-(3-fluorophenyl)methyl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 97077207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).