C15H13N3O4 — CID 97087687
N-(1,3-dihydroisoindol-2-yl)-2-hydroxy-3-nitrobenzamide (PubChem CID 97087687) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-(1,3-dihydroisoindol-2-yl)-2-hydroxy-3-nitrobenzamide.
| Compound Name | N-(1,3-dihydroisoindol-2-yl)-2-hydroxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 97087687 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(1,3-dihydroisoindol-2-yl)-2-hydroxy-3-nitrobenzamide |
| SMILES | O=C(NN1Cc2ccccc2C1)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H13N3O4/c19-14-12(6-3-7-13(14)18(21)22)15(20)16-17-8-10-4-1-2-5-11(10)9-17/h1-7,19H,8-9H2,(H,16,20) |
| InChIKey | SRYZABNVRCBADI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|