C15H14ClN5OS — CID 97088649
(2R)-2-(5-chlorothiophen-2-yl)-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide (PubChem CID 97088649) has the molecular formula C15H14ClN5OS and a molecular weight of 347.83 g/mol. Its IUPAC name is (2R)-2-(5-chlorothiophen-2-yl)-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide.
| Compound Name | (2R)-2-(5-chlorothiophen-2-yl)-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 97088649 |
| Molecular Formula | C15H14ClN5OS |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (2R)-2-(5-chlorothiophen-2-yl)-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Cc2nn[nH]n2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14ClN5OS/c1-9(12-6-7-13(16)23-12)15(22)17-11-4-2-10(3-5-11)8-14-18-20-21-19-14/h2-7,9H,8H2,1H3,(H,17,22)(H,18,19,20,21)/t9-/m0/s1 |
| InChIKey | IKYTZVCCFCXUSR-VIFPVBQESA-N |
| XLogP | 3.25 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |