C19H23NO2 — CID 97139052
2-[3-[[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]phenoxy]-N-methylethanamine (PubChem CID 97139052) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[3-[[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]phenoxy]-N-methylethanamine.
| Compound Name | 2-[3-[[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]phenoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 97139052 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[3-[[(3S)-3,4-dihydro-2H-chromen-3-yl]methyl]phenoxy]-N-methylethanamine |
| SMILES | CNCCOc1cccc(C[C@@H]2COc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H23NO2/c1-20-9-10-21-18-7-4-5-15(13-18)11-16-12-17-6-2-3-8-19(17)22-14-16/h2-8,13,16,20H,9-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | KPQFAGRGYWJAJG-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|