C18H21ClN4O2S — CID 97151425
N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]-5-[(2R)-oxolan-2-yl]thiophene-2-carboxamide (PubChem CID 97151425) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]-5-[(2R)-oxolan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]-5-[(2R)-oxolan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97151425 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]-5-[(2R)-oxolan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccc(Cl)nn2)CC1)c1ccc([C@H]2CCCO2)s1 |
| InChI | InChI=1S/C18H21ClN4O2S/c19-16-5-6-17(22-21-16)23-9-7-12(8-10-23)20-18(24)15-4-3-14(26-15)13-2-1-11-25-13/h3-6,12-13H,1-2,7-11H2,(H,20,24)/t13-/m1/s1 |
| InChIKey | VLEDAHBIUCYFEJ-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |