C8H12N2O6 — CID 97161602
1-O-[(2R,3R)-3-aminooxetan-2-yl] 2-O-[(2S,3S)-3-aminooxetan-2-yl] oxalate (PubChem CID 97161602) has the molecular formula C8H12N2O6 and a molecular weight of 232.19 g/mol. Its IUPAC name is 1-O-[(2R,3R)-3-aminooxetan-2-yl] 2-O-[(2S,3S)-3-aminooxetan-2-yl] oxalate.
| Compound Name | 1-O-[(2R,3R)-3-aminooxetan-2-yl] 2-O-[(2S,3S)-3-aminooxetan-2-yl] oxalate |
|---|---|
| PubChem CID | 97161602 |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-O-[(2R,3R)-3-aminooxetan-2-yl] 2-O-[(2S,3S)-3-aminooxetan-2-yl] oxalate |
| SMILES | N[C@@H]1CO[C@@H]1OC(=O)C(=O)O[C@@H]1OC[C@@H]1N |
| InChI | InChI=1S/C8H12N2O6/c9-3-1-13-7(3)15-5(11)6(12)16-8-4(10)2-14-8/h3-4,7-8H,1-2,9-10H2/t3-,4+,7-,8+ |
| InChIKey | WUMASPLSIOTVFH-DDYGQXQVSA-N |
| XLogP | -2.56 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|