C20H23N3O2 — CID 97195341
(4S)-1-[6-(methoxymethyl)pyrimidin-4-yl]spiro[azepane-4,2'-chromene] (PubChem CID 97195341) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (4S)-1-[6-(methoxymethyl)pyrimidin-4-yl]spiro[azepane-4,2'-chromene].
| Compound Name | (4S)-1-[6-(methoxymethyl)pyrimidin-4-yl]spiro[azepane-4,2'-chromene] |
|---|---|
| PubChem CID | 97195341 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (4S)-1-[6-(methoxymethyl)pyrimidin-4-yl]spiro[azepane-4,2'-chromene] |
| SMILES | COCc1cc(N2CCC[C@@]3(C=Cc4ccccc4O3)CC2)ncn1 |
| InChI | InChI=1S/C20H23N3O2/c1-24-14-17-13-19(22-15-21-17)23-11-4-8-20(10-12-23)9-7-16-5-2-3-6-18(16)25-20/h2-3,5-7,9,13,15H,4,8,10-12,14H2,1H3/t20-/m1/s1 |
| InChIKey | GYXKWIGMYHMOLG-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |