C18H22N4O3S — CID 97212363
(3R,4S)-1,1-dioxo-4-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]thiolan-3-ol (PubChem CID 97212363) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is (3R,4S)-1,1-dioxo-4-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]thiolan-3-ol.
| Compound Name | (3R,4S)-1,1-dioxo-4-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 97212363 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3R,4S)-1,1-dioxo-4-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]thiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](N2CCN(c3ccnc(-c4ccccc4)n3)CC2)[C@@H](O)C1 |
| InChI | InChI=1S/C18H22N4O3S/c23-16-13-26(24,25)12-15(16)21-8-10-22(11-9-21)17-6-7-19-18(20-17)14-4-2-1-3-5-14/h1-7,15-16,23H,8-13H2/t15-,16+/m1/s1 |
| InChIKey | VWUUXWNAWRUZIM-CVEARBPZSA-N |
| XLogP | 0.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |