C14H14ClN5O2 — CID 97214919
(5R)-N-(3-chloro-5-nitro-2-pyridinyl)-2-methyl-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 97214919) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is (5R)-N-(3-chloro-5-nitro-2-pyridinyl)-2-methyl-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | (5R)-N-(3-chloro-5-nitro-2-pyridinyl)-2-methyl-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 97214919 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (5R)-N-(3-chloro-5-nitro-2-pyridinyl)-2-methyl-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | Cc1ncc2c(n1)CCC[C@H]2Nc1ncc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H14ClN5O2/c1-8-16-7-10-12(18-8)3-2-4-13(10)19-14-11(15)5-9(6-17-14)20(21)22/h5-7,13H,2-4H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | RDMQHTHHNCPRKP-CYBMUJFWSA-N |
| XLogP | 3.23 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|