C16H22ClNO3S — CID 97239330
(S)-(1-but-3-enylsulfonylpiperidin-4-yl)-(4-chlorophenyl)methanol (PubChem CID 97239330) has the molecular formula C16H22ClNO3S and a molecular weight of 343.88 g/mol. Its IUPAC name is (S)-(1-but-3-enylsulfonylpiperidin-4-yl)-(4-chlorophenyl)methanol.
| Compound Name | (S)-(1-but-3-enylsulfonylpiperidin-4-yl)-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 97239330 |
| Molecular Formula | C16H22ClNO3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (S)-(1-but-3-enylsulfonylpiperidin-4-yl)-(4-chlorophenyl)methanol |
| SMILES | C=CCCS(=O)(=O)N1CCC([C@H](O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClNO3S/c1-2-3-12-22(20,21)18-10-8-14(9-11-18)16(19)13-4-6-15(17)7-5-13/h2,4-7,14,16,19H,1,3,8-12H2/t16-/m1/s1 |
| InChIKey | ANYGPBCRGQCSTR-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|