C7H9NO2 — CID 97294863
(1R,3R,4S)-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylic acid (PubChem CID 97294863) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (1R,3R,4S)-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylic acid.
| Compound Name | (1R,3R,4S)-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 97294863 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (1R,3R,4S)-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1N[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C7H9NO2/c9-7(10)6-4-1-2-5(3-4)8-6/h1-2,4-6,8H,3H2,(H,9,10)/t4-,5+,6-/m1/s1 |
| InChIKey | LTBWRUUYOYWXEY-NGJCXOISSA-N |
| XLogP | -0.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|