C19H20N4O2 — CID 97318645
(3aR,7aS)-N-(3-pyrimidin-2-yloxyphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 97318645) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (3aR,7aS)-N-(3-pyrimidin-2-yloxyphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-N-(3-pyrimidin-2-yloxyphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 97318645 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3aR,7aS)-N-(3-pyrimidin-2-yloxyphenyl)-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ncccn2)c1)N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C19H20N4O2/c24-19(23-12-14-5-1-2-6-15(14)13-23)22-16-7-3-8-17(11-16)25-18-20-9-4-10-21-18/h1-4,7-11,14-15H,5-6,12-13H2,(H,22,24)/t14-,15+ |
| InChIKey | CFYTVUMQYOZRNX-GASCZTMLSA-N |
| XLogP | 3.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|