C22H28N6 — CID 97321769
3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[(1R)-1-quinolin-2-ylethyl]propan-1-amine (PubChem CID 97321769) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is 3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[(1R)-1-quinolin-2-ylethyl]propan-1-amine.
| Compound Name | 3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[(1R)-1-quinolin-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 97321769 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 3-(4-pyrimidin-2-ylpiperazin-1-yl)-N-[(1R)-1-quinolin-2-ylethyl]propan-1-amine |
| SMILES | C[C@@H](NCCCN1CCN(c2ncccn2)CC1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H28N6/c1-18(20-9-8-19-6-2-3-7-21(19)26-20)23-12-5-13-27-14-16-28(17-15-27)22-24-10-4-11-25-22/h2-4,6-11,18,23H,5,12-17H2,1H3/t18-/m1/s1 |
| InChIKey | JHHKOJYBRSXKRO-GOSISDBHSA-N |
| XLogP | 2.89 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|