C19H28ClN3O5S — CID 97325404
N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-[[(3R)-1,1-dioxothiolan-3-yl]amino]piperidine-1-carboxamide (PubChem CID 97325404) has the molecular formula C19H28ClN3O5S and a molecular weight of 445.97 g/mol. Its IUPAC name is N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-[[(3R)-1,1-dioxothiolan-3-yl]amino]piperidine-1-carboxamide.
| Compound Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-[[(3R)-1,1-dioxothiolan-3-yl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97325404 |
| Molecular Formula | C19H28ClN3O5S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-[[(3R)-1,1-dioxothiolan-3-yl]amino]piperidine-1-carboxamide |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)N1CCC(N[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C19H28ClN3O5S/c1-27-10-11-28-18-16(20)3-2-4-17(18)22-19(24)23-8-5-14(6-9-23)21-15-7-12-29(25,26)13-15/h2-4,14-15,21H,5-13H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | GIAJTMFXLLGWCR-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|