C24H32N2O3 — CID 97335092
ethyl 3-[4-[[(S)-(2-methoxyphenyl)-phenylmethyl]amino]piperidin-1-yl]propanoate (PubChem CID 97335092) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 3-[4-[[(S)-(2-methoxyphenyl)-phenylmethyl]amino]piperidin-1-yl]propanoate.
| Compound Name | ethyl 3-[4-[[(S)-(2-methoxyphenyl)-phenylmethyl]amino]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 97335092 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | ethyl 3-[4-[[(S)-(2-methoxyphenyl)-phenylmethyl]amino]piperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCC(N[C@@H](c2ccccc2)c2ccccc2OC)CC1 |
| InChI | InChI=1S/C24H32N2O3/c1-3-29-23(27)15-18-26-16-13-20(14-17-26)25-24(19-9-5-4-6-10-19)21-11-7-8-12-22(21)28-2/h4-12,20,24-25H,3,13-18H2,1-2H3/t24-/m0/s1 |
| InChIKey | FDENVDXISMMRBZ-DEOSSOPVSA-N |
| XLogP | 3.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |