C13H21N3O4S2 — CID 97348271
(3R)-1-N,1-N-dimethyl-3-N-phenylpiperidine-1,3-disulfonamide (PubChem CID 97348271) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3R)-1-N,1-N-dimethyl-3-N-phenylpiperidine-1,3-disulfonamide.
| Compound Name | (3R)-1-N,1-N-dimethyl-3-N-phenylpiperidine-1,3-disulfonamide |
|---|---|
| PubChem CID | 97348271 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3R)-1-N,1-N-dimethyl-3-N-phenylpiperidine-1,3-disulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H](S(=O)(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-15(2)22(19,20)16-10-6-9-13(11-16)21(17,18)14-12-7-4-3-5-8-12/h3-5,7-8,13-14H,6,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | BFTSVNREAKFGCC-CYBMUJFWSA-N |
| XLogP | 0.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |