C21H17FN2O3 — CID 97352663
[(1R)-2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] isoquinoline-4-carboxylate (PubChem CID 97352663) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] isoquinoline-4-carboxylate.
| Compound Name | [(1R)-2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 97352663 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] isoquinoline-4-carboxylate |
| SMILES | O=C(O[C@@H](C(=O)NC1CC1)c1ccc(F)cc1)c1cncc2ccccc12 |
| InChI | InChI=1S/C21H17FN2O3/c22-15-7-5-13(6-8-15)19(20(25)24-16-9-10-16)27-21(26)18-12-23-11-14-3-1-2-4-17(14)18/h1-8,11-12,16,19H,9-10H2,(H,24,25)/t19-/m1/s1 |
| InChIKey | MDNXWRBWGUGCOB-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |