C17H23N3S — CID 97356634
2-(6,9-dimethyl-7-thia-2,3-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-N,N-diethylethanamine (PubChem CID 97356634) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-(6,9-dimethyl-7-thia-2,3-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-N,N-diethylethanamine.
| Compound Name | 2-(6,9-dimethyl-7-thia-2,3-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 97356634 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(6,9-dimethyl-7-thia-2,3-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1nc2c3c(c(C)ccc31)SC(C)=C2 |
| InChI | InChI=1S/C17H23N3S/c1-5-19(6-2)9-10-20-15-8-7-12(3)17-16(15)14(18-20)11-13(4)21-17/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | PBSGTHLZMQCHOU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |