C22H27N5O3S — CID 97439128
(3aS,6aR)-2-methyl-1'-(4-methylphenyl)sulfonyl-5-pyrimidin-2-ylspiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one (PubChem CID 97439128) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is (3aS,6aR)-2-methyl-1'-(4-methylphenyl)sulfonyl-5-pyrimidin-2-ylspiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one.
| Compound Name | (3aS,6aR)-2-methyl-1'-(4-methylphenyl)sulfonyl-5-pyrimidin-2-ylspiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 97439128 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (3aS,6aR)-2-methyl-1'-(4-methylphenyl)sulfonyl-5-pyrimidin-2-ylspiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(CC2)[C@@H]2CN(c4ncccn4)C[C@@H]2C(=O)N3C)cc1 |
| InChI | InChI=1S/C22H27N5O3S/c1-16-4-6-17(7-5-16)31(29,30)27-12-8-22(9-13-27)19-15-26(21-23-10-3-11-24-21)14-18(19)20(28)25(22)2/h3-7,10-11,18-19H,8-9,12-15H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | AJUIGMAUPVOLHA-RBUKOAKNSA-N |
| XLogP | 1.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |