C17H24N4O4 — CID 97443503
(2R)-N-[4-(2-methoxyethylcarbamoyl)phenyl]-2-methyl-5-oxo-1,4-diazepane-1-carboxamide (PubChem CID 97443503) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-N-[4-(2-methoxyethylcarbamoyl)phenyl]-2-methyl-5-oxo-1,4-diazepane-1-carboxamide.
| Compound Name | (2R)-N-[4-(2-methoxyethylcarbamoyl)phenyl]-2-methyl-5-oxo-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 97443503 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R)-N-[4-(2-methoxyethylcarbamoyl)phenyl]-2-methyl-5-oxo-1,4-diazepane-1-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)N2CCC(=O)NC[C@H]2C)cc1 |
| InChI | InChI=1S/C17H24N4O4/c1-12-11-19-15(22)7-9-21(12)17(24)20-14-5-3-13(4-6-14)16(23)18-8-10-25-2/h3-6,12H,7-11H2,1-2H3,(H,18,23)(H,19,22)(H,20,24)/t12-/m1/s1 |
| InChIKey | DAIAAOWYXGRLHV-GFCCVEGCSA-N |
| XLogP | 0.81 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|