C17H19Cl2N3O — CID 97452088
(1S)-1-[6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-pyridinyl]ethanol (PubChem CID 97452088) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is (1S)-1-[6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-pyridinyl]ethanol.
| Compound Name | (1S)-1-[6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 97452088 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (1S)-1-[6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-pyridinyl]ethanol |
| SMILES | C[C@H](O)c1cccc(N2CCN(c3ccc(Cl)c(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C17H19Cl2N3O/c1-12(23)16-3-2-4-17(20-16)22-9-7-21(8-10-22)13-5-6-14(18)15(19)11-13/h2-6,11-12,23H,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | VCQQCVYBUDTDLP-LBPRGKRZSA-N |
| XLogP | 3.77 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |