C12H16N4O3S2 — CID 97463601
(6R)-6-(methoxymethyl)-8-thiophen-2-ylsulfonyl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine (PubChem CID 97463601) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (6R)-6-(methoxymethyl)-8-thiophen-2-ylsulfonyl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine.
| Compound Name | (6R)-6-(methoxymethyl)-8-thiophen-2-ylsulfonyl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 97463601 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (6R)-6-(methoxymethyl)-8-thiophen-2-ylsulfonyl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine |
| SMILES | COC[C@H]1CN(S(=O)(=O)c2cccs2)Cc2ncnn2C1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-19-8-10-5-15(7-11-13-9-14-16(11)6-10)21(17,18)12-3-2-4-20-12/h2-4,9-10H,5-8H2,1H3/t10-/m0/s1 |
| InChIKey | HAGCSBMCSRYOFS-JTQLQIEISA-N |
| XLogP | 0.81 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |