C16H23N5O2S — CID 97464344
(4S)-3-[(E)-2-methylpent-2-enoyl]-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 97464344) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is (4S)-3-[(E)-2-methylpent-2-enoyl]-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-[(E)-2-methylpent-2-enoyl]-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 97464344 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (4S)-3-[(E)-2-methylpent-2-enoyl]-N-[2-(pyrimidin-2-ylamino)ethyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC/C=C(\C)C(=O)N1CSC[C@@H]1C(=O)NCCNc1ncccn1 |
| InChI | InChI=1S/C16H23N5O2S/c1-3-5-12(2)15(23)21-11-24-10-13(21)14(22)17-8-9-20-16-18-6-4-7-19-16/h4-7,13H,3,8-11H2,1-2H3,(H,17,22)(H,18,19,20)/b12-5+/t13-/m1/s1 |
| InChIKey | IOWQWMTUTOMEFZ-YQJFHSMKSA-N |
| XLogP | 1.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|