C14H23NO3S — CID 97485583
[(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(thian-4-yl)methanone (PubChem CID 97485583) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is [(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(thian-4-yl)methanone.
| Compound Name | [(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(thian-4-yl)methanone |
|---|---|
| PubChem CID | 97485583 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | [(3aS,7S,7aS)-7-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-(thian-4-yl)methanone |
| SMILES | CO[C@H]1CCN(C(=O)C2CCSCC2)[C@H]2CCO[C@H]12 |
| InChI | InChI=1S/C14H23NO3S/c1-17-12-2-6-15(11-3-7-18-13(11)12)14(16)10-4-8-19-9-5-10/h10-13H,2-9H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | PFCJCAZULCGOQI-AVGNSLFASA-N |
| XLogP | 1.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |