C17H24N2O3 — CID 97487169
2-[(2R,3aS,6aS)-5-[(2-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide (PubChem CID 97487169) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-[(2-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide.
| Compound Name | 2-[(2R,3aS,6aS)-5-[(2-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 97487169 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-[(2-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@H]1C[C@H]2CN(Cc3ccccc3OC)C[C@H]2O1 |
| InChI | InChI=1S/C17H24N2O3/c1-18-17(20)8-14-7-13-10-19(11-16(13)22-14)9-12-5-3-4-6-15(12)21-2/h3-6,13-14,16H,7-11H2,1-2H3,(H,18,20)/t13-,14+,16+/m0/s1 |
| InChIKey | DQQJXOOVYPLPTE-SQWLQELKSA-N |
| XLogP | 1.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |